C15H14O5 — CID 24886444
2-[2-(2,4-dihydroxyphenyl)ethyl]-6-hydroxybenzoic acid (PubChem CID 24886444) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[2-(2,4-dihydroxyphenyl)ethyl]-6-hydroxybenzoic acid.
| Compound Name | 2-[2-(2,4-dihydroxyphenyl)ethyl]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 24886444 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[2-(2,4-dihydroxyphenyl)ethyl]-6-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cccc1CCc1ccc(O)cc1O |
| InChI | InChI=1S/C15H14O5/c16-11-7-6-9(13(18)8-11)4-5-10-2-1-3-12(17)14(10)15(19)20/h1-3,6-8,16-18H,4-5H2,(H,19,20) |
| InChIKey | YZCHIORSQSZSHC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |