About 2-(aminomethyl)phenol;methane
2-(aminomethyl)phenol;methane (PubChem CID 158060419) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-(aminomethyl)phenol;methane.
Molecular Properties
| Compound Name | 2-(aminomethyl)phenol;methane |
| PubChem CID | 158060419 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-(aminomethyl)phenol;methane |
| SMILES | C.NCc1ccccc1O |
| InChI | InChI=1S/C7H9NO.CH4/c8-5-6-3-1-2-4-7(6)9;/h1-4,9H,5,8H2;1H4 |
| InChIKey | FKOOKCZGKWQZNR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)phenol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)phenol;methane?
The IUPAC name of 2-(aminomethyl)phenol;methane (CID 158060419) is 2-(aminomethyl)phenol;methane.
What is the SMILES notation for 2-(aminomethyl)phenol;methane?
The canonical SMILES for 2-(aminomethyl)phenol;methane is C.NCc1ccccc1O.
What is the InChIKey of 2-(aminomethyl)phenol;methane?
The InChIKey is FKOOKCZGKWQZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.CH4/c8-5-6-3-1-2-4-7(6)9;/h1-4,9H,5,8H2;1H4.
What are the key properties of 2-(aminomethyl)phenol;methane?
2-(aminomethyl)phenol;methane has a molecular weight of 139.20 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)phenol;methane is sourced from PubChem (CID 158060419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).