About CID 147052016
CID 147052016 (PubChem CID 147052016) has the molecular formula C7H7AlO
and a molecular weight of 134.11 g/mol.
Molecular Properties
| Compound Name | CID 147052016 |
| PubChem CID | 147052016 |
| Molecular Formula | C7H7AlO |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1C[Al] |
| InChI | InChI=1S/C7H7O.Al/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H2; |
| InChIKey | FXSMNILHBITAFZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 147052016 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147052016?
The IUPAC name of CID 147052016 (CID 147052016) is not available.
What is the SMILES notation for CID 147052016?
The canonical SMILES for CID 147052016 is Oc1ccccc1C[Al].
What is the InChIKey of CID 147052016?
The InChIKey is FXSMNILHBITAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O.Al/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H2;.
What are the key properties of CID 147052016?
CID 147052016 has a molecular weight of 134.11 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147052016 is sourced from PubChem (CID 147052016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).