C9H18N2O2 — CID 175003678
benzene-1,2-diol;ethane-1,2-diamine;methane (PubChem CID 175003678) has the molecular formula C9H18N2O2 and a molecular weight of 186.26 g/mol. Its IUPAC name is benzene-1,2-diol;ethane-1,2-diamine;methane.
| Compound Name | benzene-1,2-diol;ethane-1,2-diamine;methane |
|---|---|
| PubChem CID | 175003678 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | benzene-1,2-diol;ethane-1,2-diamine;methane |
| SMILES | C.NCCN.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H8N2.CH4/c7-5-3-1-2-4-6(5)8;3-1-2-4;/h1-4,7-8H;1-4H2;1H4 |
| InChIKey | ZYZOCVSVNGFRCQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|