About benzene-1,2-diol;ethanol;hydroxylamine
benzene-1,2-diol;ethanol;hydroxylamine (PubChem CID 70173315) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is benzene-1,2-diol;ethanol;hydroxylamine.
Molecular Properties
| Compound Name | benzene-1,2-diol;ethanol;hydroxylamine |
| PubChem CID | 70173315 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | benzene-1,2-diol;ethanol;hydroxylamine |
| SMILES | CCO.NO.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H6O.H3NO/c7-5-3-1-2-4-6(5)8;1-2-3;1-2/h1-4,7-8H;3H,2H2,1H3;2H,1H2 |
| InChIKey | OABOPUOHIUCSID-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;ethanol;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;ethanol;hydroxylamine?
The IUPAC name of benzene-1,2-diol;ethanol;hydroxylamine (CID 70173315) is benzene-1,2-diol;ethanol;hydroxylamine.
What is the SMILES notation for benzene-1,2-diol;ethanol;hydroxylamine?
The canonical SMILES for benzene-1,2-diol;ethanol;hydroxylamine is CCO.NO.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;ethanol;hydroxylamine?
The InChIKey is OABOPUOHIUCSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H6O.H3NO/c7-5-3-1-2-4-6(5)8;1-2-3;1-2/h1-4,7-8H;3H,2H2,1H3;2H,1H2.
What are the key properties of benzene-1,2-diol;ethanol;hydroxylamine?
benzene-1,2-diol;ethanol;hydroxylamine has a molecular weight of 189.21 g/mol, XLogP of 0.43, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;ethanol;hydroxylamine is sourced from PubChem (CID 70173315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).