About ethanol;naphthalene
ethanol;naphthalene (PubChem CID 91408804) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is ethanol;naphthalene.
Molecular Properties
| Compound Name | ethanol;naphthalene |
| PubChem CID | 91408804 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | ethanol;naphthalene |
| SMILES | CCO.CCO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C2H6O/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-2-3/h1-8H;2*3H,2H2,1H3 |
| InChIKey | KXGQYTVFZLIEIF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;naphthalene?
The IUPAC name of ethanol;naphthalene (CID 91408804) is ethanol;naphthalene.
What is the SMILES notation for ethanol;naphthalene?
The canonical SMILES for ethanol;naphthalene is CCO.CCO.c1ccc2ccccc2c1.
What is the InChIKey of ethanol;naphthalene?
The InChIKey is KXGQYTVFZLIEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C2H6O/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-2-3/h1-8H;2*3H,2H2,1H3.
What are the key properties of ethanol;naphthalene?
ethanol;naphthalene has a molecular weight of 220.31 g/mol, XLogP of 2.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;naphthalene is sourced from PubChem (CID 91408804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).