About butane;ethane;naphthalene
butane;ethane;naphthalene (PubChem CID 54028407) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is butane;ethane;naphthalene.
Molecular Properties
| Compound Name | butane;ethane;naphthalene |
| PubChem CID | 54028407 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | butane;ethane;naphthalene |
| SMILES | CC.CC.CCCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C4H10.2C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-4-2;2*1-2/h1-8H;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | LDVPGWAYSIEKJS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;ethane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;naphthalene?
The IUPAC name of butane;ethane;naphthalene (CID 54028407) is butane;ethane;naphthalene.
What is the SMILES notation for butane;ethane;naphthalene?
The canonical SMILES for butane;ethane;naphthalene is CC.CC.CCCC.c1ccc2ccccc2c1.
What is the InChIKey of butane;ethane;naphthalene?
The InChIKey is LDVPGWAYSIEKJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C4H10.2C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-4-2;2*1-2/h1-8H;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;naphthalene?
butane;ethane;naphthalene has a molecular weight of 246.44 g/mol, XLogP of 6.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;naphthalene is sourced from PubChem (CID 54028407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).