About butane;ethane;naphthalene
butane;ethane;naphthalene (PubChem CID 91209744) has the molecular formula C20H34
and a molecular weight of 274.49 g/mol. Its IUPAC name is butane;ethane;naphthalene.
Molecular Properties
| Compound Name | butane;ethane;naphthalene |
| PubChem CID | 91209744 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | butane;ethane;naphthalene |
| SMILES | CC.CCCC.CCCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C4H10.C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-3-4-2;1-2/h1-8H;2*3-4H2,1-2H3;1-2H3 |
| InChIKey | FLWNSOYMZRQZKV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;ethane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;naphthalene?
The IUPAC name of butane;ethane;naphthalene (CID 91209744) is butane;ethane;naphthalene.
What is the SMILES notation for butane;ethane;naphthalene?
The canonical SMILES for butane;ethane;naphthalene is CC.CCCC.CCCC.c1ccc2ccccc2c1.
What is the InChIKey of butane;ethane;naphthalene?
The InChIKey is FLWNSOYMZRQZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C4H10.C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-3-4-2;1-2/h1-8H;2*3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;naphthalene?
butane;ethane;naphthalene has a molecular weight of 274.49 g/mol, XLogP of 7.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;naphthalene is sourced from PubChem (CID 91209744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).