About butane;chrysene;ethane
butane;chrysene;ethane (PubChem CID 143984277) has the molecular formula C24H28
and a molecular weight of 316.49 g/mol. Its IUPAC name is butane;chrysene;ethane.
Molecular Properties
| Compound Name | butane;chrysene;ethane |
| PubChem CID | 143984277 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | butane;chrysene;ethane |
| SMILES | CC.CCCC.c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12.C4H10.C2H6/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-4-2;1-2/h1-12H;3-4H2,1-2H3;1-2H3 |
| InChIKey | CSBPECUOWRGBKJ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze butane;chrysene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;chrysene;ethane?
The IUPAC name of butane;chrysene;ethane (CID 143984277) is butane;chrysene;ethane.
What is the SMILES notation for butane;chrysene;ethane?
The canonical SMILES for butane;chrysene;ethane is CC.CCCC.c1ccc2c(c1)ccc1c3ccccc3ccc21.
What is the InChIKey of butane;chrysene;ethane?
The InChIKey is CSBPECUOWRGBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C4H10.C2H6/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-4-2;1-2/h1-12H;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;chrysene;ethane?
butane;chrysene;ethane has a molecular weight of 316.49 g/mol, XLogP of 7.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;chrysene;ethane is sourced from PubChem (CID 143984277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).