About heptane;phenanthrene
heptane;phenanthrene (PubChem CID 157482146) has the molecular formula C21H26
and a molecular weight of 278.44 g/mol. Its IUPAC name is heptane;phenanthrene.
Molecular Properties
| Compound Name | heptane;phenanthrene |
| PubChem CID | 157482146 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | heptane;phenanthrene |
| SMILES | CCCCCCC.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C7H16/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-5-7-6-4-2/h1-10H;3-7H2,1-2H3 |
| InChIKey | BWGZZQGWDUHNMF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze heptane;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;phenanthrene?
The IUPAC name of heptane;phenanthrene (CID 157482146) is heptane;phenanthrene.
What is the SMILES notation for heptane;phenanthrene?
The canonical SMILES for heptane;phenanthrene is CCCCCCC.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of heptane;phenanthrene?
The InChIKey is BWGZZQGWDUHNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C7H16/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-5-7-6-4-2/h1-10H;3-7H2,1-2H3.
What are the key properties of heptane;phenanthrene?
heptane;phenanthrene has a molecular weight of 278.44 g/mol, XLogP of 6.97, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;phenanthrene is sourced from PubChem (CID 157482146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).