C17H22N2O5 — CID 57388216
3-[(2,4-dihydroxyphenyl)methyl]-1-[2-(methoxymethyl)pyrrolidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 57388216) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-1-[2-(methoxymethyl)pyrrolidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-[2-(methoxymethyl)pyrrolidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 57388216 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-[2-(methoxymethyl)pyrrolidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | COCC1CCCN1N1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C17H22N2O5/c1-24-10-13-3-2-6-18(13)19-16(22)8-12(17(19)23)7-11-4-5-14(20)9-15(11)21/h4-5,9,12-13,20-21H,2-3,6-8,10H2,1H3 |
| InChIKey | PRHVXBQWIBMHGZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|