C18H24N2O4 — CID 110457776
tert-butyl N-[[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]phenyl]methyl]carbamate (PubChem CID 110457776) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 110457776 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]phenyl]methyl]carbamate |
| SMILES | CN1C(=O)CC(Cc2ccc(CNC(=O)OC(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(23)19-11-13-7-5-12(6-8-13)9-14-10-15(21)20(4)16(14)22/h5-8,14H,9-11H2,1-4H3,(H,19,23) |
| InChIKey | IRLLMDBSFTZHAO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|