C10H13NO6 — CID 125471780
dimethyl 2-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]propanedioate (PubChem CID 125471780) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is dimethyl 2-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]propanedioate |
|---|---|
| PubChem CID | 125471780 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | dimethyl 2-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C10H13NO6/c1-11-6(12)4-5(8(11)13)7(9(14)16-2)10(15)17-3/h5,7H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | VDLDIJWADAJFJS-RXMQYKEDSA-N |
| XLogP | -1.05 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|