C10H16N2O4 — CID 58735408
tert-butyl N-(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamate (PubChem CID 58735408) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is tert-butyl N-(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 58735408 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | tert-butyl N-(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamate |
| SMILES | CN1C(=O)CC(NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C10H16N2O4/c1-10(2,3)16-9(15)11-6-5-7(13)12(4)8(6)14/h6H,5H2,1-4H3,(H,11,15) |
| InChIKey | FTTQLYBBZLGHLR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|