C9H17N3O3 — CID 45092234
tert-butyl N-[(3S)-1-amino-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 45092234) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-amino-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-amino-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 45092234 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | tert-butyl N-[(3S)-1-amino-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(N)C1=O |
| InChI | InChI=1S/C9H17N3O3/c1-9(2,3)15-8(14)11-6-4-5-12(10)7(6)13/h6H,4-5,10H2,1-3H3,(H,11,14)/t6-/m0/s1 |
| InChIKey | XGBZAAMECNYFKT-LURJTMIESA-N |
| XLogP | -0.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|