C14H25N3O4 — CID 21101908
tert-butyl N-[(3S)-1-(dimethylcarbamoyl)-2-oxoazepan-3-yl]carbamate (PubChem CID 21101908) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(dimethylcarbamoyl)-2-oxoazepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(dimethylcarbamoyl)-2-oxoazepan-3-yl]carbamate |
|---|---|
| PubChem CID | 21101908 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | tert-butyl N-[(3S)-1-(dimethylcarbamoyl)-2-oxoazepan-3-yl]carbamate |
| SMILES | CN(C)C(=O)N1CCCC[C@H](NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H25N3O4/c1-14(2,3)21-12(19)15-10-8-6-7-9-17(11(10)18)13(20)16(4)5/h10H,6-9H2,1-5H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | HGQWORKKSOXKGG-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |