C10H16N2O3 — CID 58708342
3-methyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)butanamide (PubChem CID 58708342) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-methyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)butanamide.
| Compound Name | 3-methyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 58708342 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-methyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)butanamide |
| SMILES | CC(C)CC(=O)NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C10H16N2O3/c1-6(2)4-8(13)11-7-5-9(14)12(3)10(7)15/h6-7H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | NGIQRDWEEGYYFI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|