C12H19N3O3 — CID 164638967
1-cyclopentyl-1-methyl-3-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]urea (PubChem CID 164638967) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-cyclopentyl-1-methyl-3-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]urea.
| Compound Name | 1-cyclopentyl-1-methyl-3-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 164638967 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-cyclopentyl-1-methyl-3-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]urea |
| SMILES | CN1C(=O)C[C@H](NC(=O)N(C)C2CCCC2)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-14(8-5-3-4-6-8)12(18)13-9-7-10(16)15(2)11(9)17/h8-9H,3-7H2,1-2H3,(H,13,18)/t9-/m0/s1 |
| InChIKey | BHEOTDFFKLYTFN-VIFPVBQESA-N |
| XLogP | 0.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|