C10H15N3O3 — CID 116656505
N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxamide (PubChem CID 116656505) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 116656505 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrrolidine-1-carboxamide |
| SMILES | CN1C(=O)CC(NC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C10H15N3O3/c1-12-8(14)6-7(9(12)15)11-10(16)13-4-2-3-5-13/h7H,2-6H2,1H3,(H,11,16) |
| InChIKey | DHNQQOPFEKMHAW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|