C13H19N3O5 — CID 81120954
(3R)-1-[(1-methyl-2,6-dioxopiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 81120954) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R)-1-[(1-methyl-2,6-dioxopiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(1-methyl-2,6-dioxopiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120954 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (3R)-1-[(1-methyl-2,6-dioxopiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CN1C(=O)CCC(NC(=O)N2CCC[C@@H](C(=O)O)C2)C1=O |
| InChI | InChI=1S/C13H19N3O5/c1-15-10(17)5-4-9(11(15)18)14-13(21)16-6-2-3-8(7-16)12(19)20/h8-9H,2-7H2,1H3,(H,14,21)(H,19,20)/t8-,9?/m1/s1 |
| InChIKey | IUWWQCLATRUFAO-VEDVMXKPSA-N |
| XLogP | -0.36 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|