C8H15N3O2 — CID 103390234
3-(1-aminopropan-2-ylamino)-1-methylpyrrolidine-2,5-dione (PubChem CID 103390234) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-(1-aminopropan-2-ylamino)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(1-aminopropan-2-ylamino)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 103390234 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-(1-aminopropan-2-ylamino)-1-methylpyrrolidine-2,5-dione |
| SMILES | CC(CN)NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H15N3O2/c1-5(4-9)10-6-3-7(12)11(2)8(6)13/h5-6,10H,3-4,9H2,1-2H3 |
| InChIKey | MTBFUUDQRGDVGD-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|