C12H15N3O2 — CID 43636029
1-methyl-3-(1-pyridin-4-ylethylamino)pyrrolidine-2,5-dione (PubChem CID 43636029) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-methyl-3-(1-pyridin-4-ylethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-(1-pyridin-4-ylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43636029 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-methyl-3-(1-pyridin-4-ylethylamino)pyrrolidine-2,5-dione |
| SMILES | CC(NC1CC(=O)N(C)C1=O)c1ccncc1 |
| InChI | InChI=1S/C12H15N3O2/c1-8(9-3-5-13-6-4-9)14-10-7-11(16)15(2)12(10)17/h3-6,8,10,14H,7H2,1-2H3 |
| InChIKey | XLUNOKRGDZJBJR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|