C10H15NO4 — CID 46183778
tert-butyl 1-methyl-2,5-dioxopyrrolidine-3-carboxylate (PubChem CID 46183778) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is tert-butyl 1-methyl-2,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 1-methyl-2,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 46183778 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | tert-butyl 1-methyl-2,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CN1C(=O)CC(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C10H15NO4/c1-10(2,3)15-9(14)6-5-7(12)11(4)8(6)13/h6H,5H2,1-4H3 |
| InChIKey | GUAKFFMNDWGPIX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|