C9H11NO6 — CID 125471699
dimethyl 2-[(3R)-2,5-dioxopyrrolidin-3-yl]propanedioate (PubChem CID 125471699) has the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. Its IUPAC name is dimethyl 2-[(3R)-2,5-dioxopyrrolidin-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(3R)-2,5-dioxopyrrolidin-3-yl]propanedioate |
|---|---|
| PubChem CID | 125471699 |
| Molecular Formula | C9H11NO6 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | dimethyl 2-[(3R)-2,5-dioxopyrrolidin-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C9H11NO6/c1-15-8(13)6(9(14)16-2)4-3-5(11)10-7(4)12/h4,6H,3H2,1-2H3,(H,10,11,12)/t4-/m1/s1 |
| InChIKey | QZCZQELGVNORNE-SCSAIBSYSA-N |
| XLogP | -1.39 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|