C6H8N2O4 — CID 110459456
methyl N-(2,5-dioxopyrrolidin-3-yl)carbamate (PubChem CID 110459456) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is methyl N-(2,5-dioxopyrrolidin-3-yl)carbamate.
| Compound Name | methyl N-(2,5-dioxopyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 110459456 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | methyl N-(2,5-dioxopyrrolidin-3-yl)carbamate |
| SMILES | COC(=O)NC1CC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O4/c1-12-6(11)7-3-2-4(9)8-5(3)10/h3H,2H2,1H3,(H,7,11)(H,8,9,10) |
| InChIKey | IUBMQNUMTPGSJZ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|