C4H6N2O3 — CID 22569755
3-(hydroxyamino)pyrrolidine-2,5-dione (PubChem CID 22569755) has the molecular formula C4H6N2O3 and a molecular weight of 130.10 g/mol. Its IUPAC name is 3-(hydroxyamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(hydroxyamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22569755 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 3-(hydroxyamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NO)C(=O)N1 |
| InChI | InChI=1S/C4H6N2O3/c7-3-1-2(6-9)4(8)5-3/h2,6,9H,1H2,(H,5,7,8) |
| InChIKey | TZPRWZNNLUOTGE-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|