C6H13Cl2N3O2 — CID 134691153
3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride (PubChem CID 134691153) has the molecular formula C6H13Cl2N3O2 and a molecular weight of 230.09 g/mol. Its IUPAC name is 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride.
| Compound Name | 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 134691153 |
| Molecular Formula | C6H13Cl2N3O2 |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCNC1CC(=O)NC1=O |
| InChI | InChI=1S/C6H11N3O2.2ClH/c7-1-2-8-4-3-5(10)9-6(4)11;;/h4,8H,1-3,7H2,(H,9,10,11);2*1H |
| InChIKey | MVKZABQTIFOXDF-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|