About 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride
3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride (PubChem CID 134691153) has the molecular formula C6H13Cl2N3O2
and a molecular weight of 230.09 g/mol. Its IUPAC name is 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride.
Molecular Properties
| Compound Name | 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride |
| PubChem CID | 134691153 |
| Molecular Formula | C6H13Cl2N3O2 |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCNC1CC(=O)NC1=O |
| InChI | InChI=1S/C6H11N3O2.2ClH/c7-1-2-8-4-3-5(10)9-6(4)11;;/h4,8H,1-3,7H2,(H,9,10,11);2*1H |
| InChIKey | MVKZABQTIFOXDF-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride?
The IUPAC name of 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride (CID 134691153) is 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride.
What is the SMILES notation for 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride?
The canonical SMILES for 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride is Cl.Cl.NCCNC1CC(=O)NC1=O.
What is the InChIKey of 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride?
The InChIKey is MVKZABQTIFOXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2.2ClH/c7-1-2-8-4-3-5(10)9-6(4)11;;/h4,8H,1-3,7H2,(H,9,10,11);2*1H.
What are the key properties of 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride?
3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride has a molecular weight of 230.09 g/mol, XLogP of -1.21, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethylamino)pyrrolidine-2,5-dione;dihydrochloride is sourced from PubChem (CID 134691153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).