C8H12N2O2 — CID 114616626
3-(2-methylprop-2-enylamino)pyrrolidine-2,5-dione (PubChem CID 114616626) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(2-methylprop-2-enylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-methylprop-2-enylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 114616626 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-(2-methylprop-2-enylamino)pyrrolidine-2,5-dione |
| SMILES | C=C(C)CNC1CC(=O)NC1=O |
| InChI | InChI=1S/C8H12N2O2/c1-5(2)4-9-6-3-7(11)10-8(6)12/h6,9H,1,3-4H2,2H3,(H,10,11,12) |
| InChIKey | YMGLJVCLCHXHEO-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|