C10H14N2O2 — CID 130899178
3-(3-bicyclo[3.1.0]hexanylamino)pyrrolidine-2,5-dione (PubChem CID 130899178) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(3-bicyclo[3.1.0]hexanylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-bicyclo[3.1.0]hexanylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130899178 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(3-bicyclo[3.1.0]hexanylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NC2CC3CC3C2)C(=O)N1 |
| InChI | InChI=1S/C10H14N2O2/c13-9-4-8(10(14)12-9)11-7-2-5-1-6(5)3-7/h5-8,11H,1-4H2,(H,12,13,14) |
| InChIKey | SLKOJNWPTAZMMV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|