C9H13N3O3 — CID 94349911
(3R)-3-[[(3S)-2-oxopiperidin-3-yl]amino]pyrrolidine-2,5-dione (PubChem CID 94349911) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is (3R)-3-[[(3S)-2-oxopiperidin-3-yl]amino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[[(3S)-2-oxopiperidin-3-yl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 94349911 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (3R)-3-[[(3S)-2-oxopiperidin-3-yl]amino]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N[C@H]2CCCNC2=O)C(=O)N1 |
| InChI | InChI=1S/C9H13N3O3/c13-7-4-6(9(15)12-7)11-5-2-1-3-10-8(5)14/h5-6,11H,1-4H2,(H,10,14)(H,12,13,15)/t5-,6+/m0/s1 |
| InChIKey | YVCWIAIUQQJRFU-NTSWFWBYSA-N |
| XLogP | -1.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|