C8H13N3O3 — CID 110479878
2-(dimethylamino)-N-(2,5-dioxopyrrolidin-3-yl)acetamide (PubChem CID 110479878) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2,5-dioxopyrrolidin-3-yl)acetamide.
| Compound Name | 2-(dimethylamino)-N-(2,5-dioxopyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 110479878 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(dimethylamino)-N-(2,5-dioxopyrrolidin-3-yl)acetamide |
| SMILES | CN(C)CC(=O)NC1CC(=O)NC1=O |
| InChI | InChI=1S/C8H13N3O3/c1-11(2)4-7(13)9-5-3-6(12)10-8(5)14/h5H,3-4H2,1-2H3,(H,9,13)(H,10,12,14) |
| InChIKey | RMZDAEXBPYQHEO-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|