C11H19N3O3 — CID 113408373
2-[(2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide (PubChem CID 113408373) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[(2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113408373 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[(2,5-dioxopyrrolidin-3-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC1CC(=O)NC1=O |
| InChI | InChI=1S/C11H19N3O3/c1-4-14(5-2)11(17)7(3)12-8-6-9(15)13-10(8)16/h7-8,12H,4-6H2,1-3H3,(H,13,15,16) |
| InChIKey | AIYLVQXIYXCYER-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|