C10H20N2O — CID 43113043
2-(cyclopropylamino)-N,N-diethylpropanamide (PubChem CID 43113043) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N,N-diethylpropanamide.
| Compound Name | 2-(cyclopropylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43113043 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-(cyclopropylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC1CC1 |
| InChI | InChI=1S/C10H20N2O/c1-4-12(5-2)10(13)8(3)11-9-6-7-9/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | GFGALCKNJMFWDR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |