C15H30N2O — CID 43739395
2-[(2,6-dimethylcyclohexyl)amino]-N,N-diethylpropanamide (PubChem CID 43739395) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-[(2,6-dimethylcyclohexyl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[(2,6-dimethylcyclohexyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43739395 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-[(2,6-dimethylcyclohexyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC1C(C)CCCC1C |
| InChI | InChI=1S/C15H30N2O/c1-6-17(7-2)15(18)13(5)16-14-11(3)9-8-10-12(14)4/h11-14,16H,6-10H2,1-5H3 |
| InChIKey | SNHSXCHBKMDGGU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |