C11H21N3OS — CID 116509964
2-(cyclopropylcarbamothioylamino)-N,N-diethylpropanamide (PubChem CID 116509964) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 2-(cyclopropylcarbamothioylamino)-N,N-diethylpropanamide.
| Compound Name | 2-(cyclopropylcarbamothioylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 116509964 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(cyclopropylcarbamothioylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H21N3OS/c1-4-14(5-2)10(15)8(3)12-11(16)13-9-6-7-9/h8-9H,4-7H2,1-3H3,(H2,12,13,16) |
| InChIKey | BLBPHGOAZBICEH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|