C11H20N2OS2 — CID 94871924
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 94871924) has the molecular formula C11H20N2OS2 and a molecular weight of 260.43 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 94871924 |
| Molecular Formula | C11H20N2OS2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H20N2OS2/c1-4-13(5-2)11(15)16-8(3)10(14)12-9-6-7-9/h8-9H,4-7H2,1-3H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | DPMLLLGPFFBLQJ-MRVPVSSYSA-N |
| XLogP | 2.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|