C14H17F3N2OS2 — CID 7841436
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 7841436) has the molecular formula C14H17F3N2OS2 and a molecular weight of 350.43 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841436 |
| Molecular Formula | C14H17F3N2OS2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2OS2/c1-4-19(5-2)14(21)22-8(3)13(20)18-10-7-6-9(15)11(16)12(10)17/h6-8H,4-5H2,1-3H3,(H,18,20)/t8-/m0/s1 |
| InChIKey | IJATUBBWEPRNNP-QMMMGPOBSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|