C15H21BrN2OS2 — CID 9461170
[(2R)-1-(2-bromo-4-methylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 9461170) has the molecular formula C15H21BrN2OS2 and a molecular weight of 389.38 g/mol. Its IUPAC name is [(2R)-1-(2-bromo-4-methylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2R)-1-(2-bromo-4-methylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 9461170 |
| Molecular Formula | C15H21BrN2OS2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | [(2R)-1-(2-bromo-4-methylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)C(=O)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C15H21BrN2OS2/c1-5-18(6-2)15(20)21-11(4)14(19)17-13-8-7-10(3)9-12(13)16/h7-9,11H,5-6H2,1-4H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | IONPCWCOZSVXJL-LLVKDONJSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|