C14H18ClFN2OS2 — CID 9461129
[(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 9461129) has the molecular formula C14H18ClFN2OS2 and a molecular weight of 348.90 g/mol. Its IUPAC name is [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 9461129 |
| Molecular Formula | C14H18ClFN2OS2 |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H18ClFN2OS2/c1-4-18(5-2)14(20)21-9(3)13(19)17-12-7-6-10(15)8-11(12)16/h6-9H,4-5H2,1-3H3,(H,17,19)/t9-/m1/s1 |
| InChIKey | MSWSEGJHRHRFFF-SECBINFHSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|