C16H25N3OS2 — CID 42989770
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 42989770) has the molecular formula C16H25N3OS2 and a molecular weight of 339.53 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 42989770 |
| Molecular Formula | C16H25N3OS2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC(C)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H25N3OS2/c1-6-19(7-2)16(21)22-12(3)15(20)17-13-8-10-14(11-9-13)18(4)5/h8-12H,6-7H2,1-5H3,(H,17,20) |
| InChIKey | MTTKPRZTKSQIAG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|