C18H27N3O2S2 — CID 7753295
[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 7753295) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7753295 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-4-20(5-2)18(24)25-14(3)17(22)19-15-6-8-16(9-7-15)21-10-12-23-13-11-21/h6-9,14H,4-5,10-13H2,1-3H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | SGNSBBIPTABOEF-AWEZNQCLSA-N |
| XLogP | 3.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|