C18H27N3O2S2 — CID 8818310
[(2S)-1-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 8818310) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is [(2S)-1-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2S)-1-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818310 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [(2S)-1-[methyl-[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C)C(=O)N(C)CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-6-21(7-2)18(24)25-14(4)17(23)20(5)12-16(22)19-15-10-8-13(3)9-11-15/h8-11,14H,6-7,12H2,1-5H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | FLJZYOALRKJQTH-AWEZNQCLSA-N |
| XLogP | 3.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|