C20H24N2OS2 — CID 8818276
[(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate (PubChem CID 8818276) has the molecular formula C20H24N2OS2 and a molecular weight of 372.56 g/mol. Its IUPAC name is [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818276 |
| Molecular Formula | C20H24N2OS2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(1S)-2-(4-methylanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C(=O)Nc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS2/c1-4-22(5-2)20(24)25-18(16-9-7-6-8-10-16)19(23)21-17-13-11-15(3)12-14-17/h6-14,18H,4-5H2,1-3H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | IVDBKJGEXBEGHE-SFHVURJKSA-N |
| XLogP | 5.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|