C13H19NS2 — CID 150585261
[(1R)-1-phenylethyl] N,N-diethylcarbamodithioate (PubChem CID 150585261) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1R)-1-phenylethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 150585261 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(1R)-1-phenylethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H19NS2/c1-4-14(5-2)13(15)16-11(3)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3/t11-/m1/s1 |
| InChIKey | IORXXJYXFUOEKV-LLVKDONJSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|