C19H21FN2OS2 — CID 7841320
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate (PubChem CID 7841320) has the molecular formula C19H21FN2OS2 and a molecular weight of 376.52 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841320 |
| Molecular Formula | C19H21FN2OS2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21FN2OS2/c1-3-22(4-2)19(24)25-17(14-8-6-5-7-9-14)18(23)21-16-12-10-15(20)11-13-16/h5-13,17H,3-4H2,1-2H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | INOYCZBWZWWKSJ-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|