C13H18N2OS2 — CID 46689906
(2-amino-2-oxo-1-phenylethyl) N,N-diethylcarbamodithioate (PubChem CID 46689906) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) N,N-diethylcarbamodithioate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 46689906 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C13H18N2OS2/c1-3-15(4-2)13(17)18-11(12(14)16)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3,(H2,14,16) |
| InChIKey | AMRQJCBQPNQPJD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|