C20H25NS2Se — CID 138983211
(2-benzylselanyl-1-phenylethyl) N,N-diethylcarbamodithioate (PubChem CID 138983211) has the molecular formula C20H25NS2Se and a molecular weight of 422.52 g/mol. Its IUPAC name is (2-benzylselanyl-1-phenylethyl) N,N-diethylcarbamodithioate.
| Compound Name | (2-benzylselanyl-1-phenylethyl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 138983211 |
| Molecular Formula | C20H25NS2Se |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (2-benzylselanyl-1-phenylethyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC(C[Se]Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NS2Se/c1-3-21(4-2)20(22)23-19(18-13-9-6-10-14-18)16-24-15-17-11-7-5-8-12-17/h5-14,19H,3-4,15-16H2,1-2H3 |
| InChIKey | RHWNOBOTJIBTJZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|