C19H24NNaS2 — CID 154941220
sodium;N,N-diethylcarbamodithioate;2-phenylethylbenzene (PubChem CID 154941220) has the molecular formula C19H24NNaS2 and a molecular weight of 353.53 g/mol. Its IUPAC name is sodium;N,N-diethylcarbamodithioate;2-phenylethylbenzene.
| Compound Name | sodium;N,N-diethylcarbamodithioate;2-phenylethylbenzene |
|---|---|
| PubChem CID | 154941220 |
| Molecular Formula | C19H24NNaS2 |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | sodium;N,N-diethylcarbamodithioate;2-phenylethylbenzene |
| SMILES | CCN(CC)C(=S)[S-].[Na+].c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C5H11NS2.Na/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-6(4-2)5(7)8;/h1-10H,11-12H2;3-4H2,1-2H3,(H,7,8);/q;;+1/p-1 |
| InChIKey | FAADPUYDEQSKFR-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|