About CID 19880505
CID 19880505 (PubChem CID 19880505) has the molecular formula C10H20N2PbS4-2
and a molecular weight of 503.75 g/mol.
Molecular Properties
| Compound Name | CID 19880505 |
| PubChem CID | 19880505 |
| Molecular Formula | C10H20N2PbS4-2 |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Pb] |
| InChI | InChI=1S/2C5H11NS2.Pb/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/p-2 |
| InChIKey | UDRCIEGQSNCYGV-UHFFFAOYSA-L |
| XLogP | 1.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 19880505 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19880505?
The IUPAC name of CID 19880505 (CID 19880505) is not available.
What is the SMILES notation for CID 19880505?
The canonical SMILES for CID 19880505 is CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Pb].
What is the InChIKey of CID 19880505?
The InChIKey is UDRCIEGQSNCYGV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H11NS2.Pb/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/p-2.
What are the key properties of CID 19880505?
CID 19880505 has a molecular weight of 503.75 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19880505 is sourced from PubChem (CID 19880505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).