About zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid
zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid (PubChem CID 160652871) has the molecular formula C10H21N2S4Zn+
and a molecular weight of 362.95 g/mol. Its IUPAC name is zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid.
Molecular Properties
| Compound Name | zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid |
| PubChem CID | 160652871 |
| Molecular Formula | C10H21N2S4Zn+ |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid |
| SMILES | CCN(CC)C(=S)S.CCN(CC)C(=S)[S-].[Zn+2] |
| InChI | InChI=1S/2C5H11NS2.Zn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-1 |
| InChIKey | RKQOSDAEEGPRER-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid?
The IUPAC name of zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid (CID 160652871) is zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid.
What is the SMILES notation for zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid?
The canonical SMILES for zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid is CCN(CC)C(=S)S.CCN(CC)C(=S)[S-].[Zn+2].
What is the InChIKey of zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid?
The InChIKey is RKQOSDAEEGPRER-UHFFFAOYSA-M. The full InChI is InChI=1S/2C5H11NS2.Zn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-1.
What are the key properties of zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid?
zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid has a molecular weight of 362.95 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;N,N-diethylcarbamodithioate;diethylcarbamodithioic acid is sourced from PubChem (CID 160652871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).